C27H32ClN11O3 — CID 118253483
methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)amino]piperidin-4-yl]carbamate (PubChem CID 118253483) has the molecular formula C27H32ClN11O3 and a molecular weight of 594.08 g/mol. Its IUPAC name is methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)amino]piperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)amino]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118253483 |
| Molecular Formula | C27H32ClN11O3 |
| Molecular Weight | 594.08 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)amino]piperidin-4-yl]carbamate |
| SMILES | COC(=O)N[C@H]1CCN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)C[C@@H]1NCC(C)(C)O |
| InChI | InChI=1S/C27H32ClN11O3/c1-27(2,41)14-32-20-13-38(7-6-18(20)35-26(40)42-3)21-9-15(10-29)8-19(22(21)28)34-25-36-23(33-16-4-5-16)24-31-12-17(11-30)39(24)37-25/h8-9,12,16,18,20,32,41H,4-7,13-14H2,1-3H3,(H,35,40)(H2,33,34,36,37)/t18-,20-/m0/s1 |
| InChIKey | WCJZAXUZUFJWMP-ICSRJNTNSA-N |
| XLogP | 2.50 |
| TPSA | 188.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|