C27H34ClN11O3 — CID 118253469
methyl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)-methylamino]piperidin-4-yl]carbamate (PubChem CID 118253469) has the molecular formula C27H34ClN11O3 and a molecular weight of 596.10 g/mol. Its IUPAC name is methyl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)-methylamino]piperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)-methylamino]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118253469 |
| Molecular Formula | C27H34ClN11O3 |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | methyl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[(2-hydroxy-2-methylpropyl)-methylamino]piperidin-4-yl]carbamate |
| SMILES | CCNc1nc(Nc2cc(C#N)cc(N3CC[C@@H](NC(=O)OC)[C@H](N(C)CC(C)(C)O)C3)c2Cl)nn2c(C#N)cnc12 |
| InChI | InChI=1S/C27H34ClN11O3/c1-6-31-23-24-32-13-17(12-30)39(24)36-25(35-23)33-19-9-16(11-29)10-20(22(19)28)38-8-7-18(34-26(40)42-5)21(14-38)37(4)15-27(2,3)41/h9-10,13,18,21,41H,6-8,14-15H2,1-5H3,(H,34,40)(H2,31,33,35,36)/t18-,21-/m1/s1 |
| InChIKey | DBLLEAVMNIDKPA-WIYYLYMNSA-N |
| XLogP | 2.70 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|