C27H30ClN11O4 — CID 118263133
[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 118263133) has the molecular formula C27H30ClN11O4 and a molecular weight of 608.06 g/mol. Its IUPAC name is [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118263133 |
| Molecular Formula | C27H30ClN11O4 |
| Molecular Weight | 608.06 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CCNc1nc(Nc2cc(C#N)cc(N3CC[C@@H](NC(=O)OC)[C@H](OC(=O)[C@@H]4CCCN4)C3)c2Cl)nn2c(C#N)cnc12 |
| InChI | InChI=1S/C27H30ClN11O4/c1-3-31-23-24-33-13-16(12-30)39(24)37-26(36-23)34-19-9-15(11-29)10-20(22(19)28)38-8-6-17(35-27(41)42-2)21(14-38)43-25(40)18-5-4-7-32-18/h9-10,13,17-18,21,32H,3-8,14H2,1-2H3,(H,35,41)(H2,31,34,36,37)/t17-,18+,21-/m1/s1 |
| InChIKey | IWLSXHVUEGQMMW-LVCYWYKZSA-N |
| XLogP | 2.29 |
| TPSA | 194.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|