C23H26ClN10O6PS — CID 159446565
methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-phosphonooxypiperidin-4-yl]carbamate;sulfane (PubChem CID 159446565) has the molecular formula C23H26ClN10O6PS and a molecular weight of 637.02 g/mol. Its IUPAC name is methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-phosphonooxypiperidin-4-yl]carbamate;sulfane.
| Compound Name | methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-phosphonooxypiperidin-4-yl]carbamate;sulfane |
|---|---|
| PubChem CID | 159446565 |
| Molecular Formula | C23H26ClN10O6PS |
| Molecular Weight | 637.02 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | methyl N-[(3S,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-phosphonooxypiperidin-4-yl]carbamate;sulfane |
| SMILES | COC(=O)N[C@H]1CCN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)C[C@@H]1OP(=O)(O)O.S |
| InChI | InChI=1S/C23H24ClN10O6P.H2S/c1-39-23(35)30-15-4-5-33(11-18(15)40-41(36,37)38)17-7-12(8-25)6-16(19(17)24)29-22-31-20(28-13-2-3-13)21-27-10-14(9-26)34(21)32-22;/h6-7,10,13,15,18H,2-5,11H2,1H3,(H,30,35)(H2,36,37,38)(H2,28,29,31,32);1H2/t15-,18-;/m0./s1 |
| InChIKey | LSVGMMGQXJPUGD-NKGQWRHHSA-N |
| XLogP | 2.36 |
| TPSA | 223.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|