C25H25ClN10O4 — CID 72948682
oxetan-3-yl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-hydroxypiperidin-4-yl]carbamate (PubChem CID 72948682) has the molecular formula C25H25ClN10O4 and a molecular weight of 564.99 g/mol. Its IUPAC name is oxetan-3-yl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-hydroxypiperidin-4-yl]carbamate.
| Compound Name | oxetan-3-yl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-hydroxypiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 72948682 |
| Molecular Formula | C25H25ClN10O4 |
| Molecular Weight | 564.99 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | oxetan-3-yl N-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-hydroxypiperidin-4-yl]carbamate |
| SMILES | N#Cc1cc(Nc2nc(NC3CC3)c3ncc(C#N)n3n2)c(Cl)c(N2CC[C@@H](NC(=O)OC3COC3)[C@H](O)C2)c1 |
| InChI | InChI=1S/C25H25ClN10O4/c26-21-18(31-24-33-22(30-14-1-2-14)23-29-9-15(8-28)36(23)34-24)5-13(7-27)6-19(21)35-4-3-17(20(37)10-35)32-25(38)40-16-11-39-12-16/h5-6,9,14,16-17,20,37H,1-4,10-12H2,(H,32,38)(H2,30,31,33,34)/t17-,20-/m1/s1 |
| InChIKey | UHQWLOYGKGHCMN-YLJYHZDGSA-N |
| XLogP | 1.90 |
| TPSA | 185.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.99 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|