C24H24ClF2N11O2 — CID 118253527
[(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamic acid (PubChem CID 118253527) has the molecular formula C24H24ClF2N11O2 and a molecular weight of 571.98 g/mol. Its IUPAC name is [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamic acid.
| Compound Name | [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 118253527 |
| Molecular Formula | C24H24ClF2N11O2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]carbamic acid |
| SMILES | N#Cc1cc(Nc2nc(NC3CC3)c3ncc(C#N)n3n2)c(Cl)c(N2CC[C@H](NC(=O)O)[C@H](NCC(F)F)C2)c1 |
| InChI | InChI=1S/C24H24ClF2N11O2/c25-20-16(33-23-35-21(32-13-1-2-13)22-31-9-14(8-29)38(22)36-23)5-12(7-28)6-18(20)37-4-3-15(34-24(39)40)17(11-37)30-10-19(26)27/h5-6,9,13,15,17,19,30,34H,1-4,10-11H2,(H,39,40)(H2,32,33,35,36)/t15-,17+/m0/s1 |
| InChIKey | WOOAVMVTTUXIBP-DOTOQJQBSA-N |
| XLogP | 2.91 |
| TPSA | 179.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|