C25H26ClF2N11O2 — CID 130364261
[(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]-methylcarbamic acid (PubChem CID 130364261) has the molecular formula C25H26ClF2N11O2 and a molecular weight of 586.01 g/mol. Its IUPAC name is [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]-methylcarbamic acid.
| Compound Name | [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 130364261 |
| Molecular Formula | C25H26ClF2N11O2 |
| Molecular Weight | 586.01 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [(3R,4S)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-(2,2-difluoroethylamino)piperidin-4-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@H]1CCN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)C[C@H]1NCC(F)F |
| InChI | InChI=1S/C25H26ClF2N11O2/c1-37(25(40)41)18-4-5-38(12-17(18)31-11-20(27)28)19-7-13(8-29)6-16(21(19)26)34-24-35-22(33-14-2-3-14)23-32-10-15(9-30)39(23)36-24/h6-7,10,14,17-18,20,31H,2-5,11-12H2,1H3,(H,40,41)(H2,33,34,35,36)/t17-,18+/m1/s1 |
| InChIKey | BIGDYVSYBIRLSX-MSOLQXFVSA-N |
| XLogP | 3.25 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|