C26H30ClN11O3 — CID 130364316
[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[methyl(oxetan-3-yl)amino]piperidin-4-yl]-methylcarbamic acid (PubChem CID 130364316) has the molecular formula C26H30ClN11O3 and a molecular weight of 580.05 g/mol. Its IUPAC name is [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[methyl(oxetan-3-yl)amino]piperidin-4-yl]-methylcarbamic acid.
| Compound Name | [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[methyl(oxetan-3-yl)amino]piperidin-4-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 130364316 |
| Molecular Formula | C26H30ClN11O3 |
| Molecular Weight | 580.05 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | [(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[methyl(oxetan-3-yl)amino]piperidin-4-yl]-methylcarbamic acid |
| SMILES | CCNc1nc(Nc2cc(C#N)cc(N3CC[C@@H](N(C)C(=O)O)[C@H](N(C)C4COC4)C3)c2Cl)nn2c(C#N)cnc12 |
| InChI | InChI=1S/C26H30ClN11O3/c1-4-30-23-24-31-11-16(10-29)38(24)34-25(33-23)32-18-7-15(9-28)8-20(22(18)27)37-6-5-19(36(3)26(39)40)21(12-37)35(2)17-13-41-14-17/h7-8,11,17,19,21H,4-6,12-14H2,1-3H3,(H,39,40)(H2,30,32,33,34)/t19-,21-/m1/s1 |
| InChIKey | XHYQQRRUIMWTKP-TZIWHRDSSA-N |
| XLogP | 2.58 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.05 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|