C25H30ClN11O4 — CID 130364281
[(4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-4-yl]carbamic acid (PubChem CID 130364281) has the molecular formula C25H30ClN11O4 and a molecular weight of 584.04 g/mol. Its IUPAC name is [(4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-4-yl]carbamic acid.
| Compound Name | [(4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 130364281 |
| Molecular Formula | C25H30ClN11O4 |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | [(4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-4-yl]carbamic acid |
| SMILES | CCNc1nc(Nc2cc(C#N)cc(N3CC[C@@H](NC(=O)O)C(N(C)C[C@H](O)CO)C3)c2Cl)nn2c(C#N)cnc12 |
| InChI | InChI=1S/C25H30ClN11O4/c1-3-29-22-23-30-10-15(9-28)37(23)34-24(33-22)31-18-6-14(8-27)7-19(21(18)26)36-5-4-17(32-25(40)41)20(12-36)35(2)11-16(39)13-38/h6-7,10,16-17,20,32,38-39H,3-5,11-13H2,1-2H3,(H,40,41)(H2,29,31,33,34)/t16-,17+,20?/m0/s1 |
| InChIKey | SGTWJEOXYSVCFT-QJNHQHDKSA-N |
| XLogP | 1.20 |
| TPSA | 210.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|