C24H25ClN10O3 — CID 123235192
methyl 6-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate (PubChem CID 123235192) has the molecular formula C24H25ClN10O3 and a molecular weight of 536.98 g/mol. Its IUPAC name is methyl 6-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate.
| Compound Name | methyl 6-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 123235192 |
| Molecular Formula | C24H25ClN10O3 |
| Molecular Weight | 536.98 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | methyl 6-[2-chloro-5-cyano-3-[[7-cyano-4-(ethylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
| SMILES | CCNc1nc(Nc2cc(C#N)cc(N3CCC4C(C3)OCCN4C(=O)OC)c2Cl)nn2c(C#N)cnc12 |
| InChI | InChI=1S/C24H25ClN10O3/c1-3-28-21-22-29-12-15(11-27)35(22)32-23(31-21)30-16-8-14(10-26)9-18(20(16)25)33-5-4-17-19(13-33)38-7-6-34(17)24(36)37-2/h8-9,12,17,19H,3-7,13H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | VCIMHGCJUAAKCC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 156.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.98 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|