C29H32ClN11O5 — CID 130364267
2-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl]-2-morpholin-4-ylacetic acid (PubChem CID 130364267) has the molecular formula C29H32ClN11O5 and a molecular weight of 650.10 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl]-2-morpholin-4-ylacetic acid.
| Compound Name | 2-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl]-2-morpholin-4-ylacetic acid |
|---|---|
| PubChem CID | 130364267 |
| Molecular Formula | C29H32ClN11O5 |
| Molecular Weight | 650.10 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 2-[(3R,4R)-1-[2-chloro-5-cyano-3-[[7-cyano-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-4-(methoxycarbonylamino)piperidin-3-yl]-2-morpholin-4-ylacetic acid |
| SMILES | COC(=O)N[C@@H]1CCN(c2cc(C#N)cc(Nc3nc(NC4CC4)c4ncc(C#N)n4n3)c2Cl)C[C@H]1C(C(=O)O)N1CCOCC1 |
| InChI | InChI=1S/C29H32ClN11O5/c1-45-29(44)36-20-4-5-40(15-19(20)24(27(42)43)39-6-8-46-9-7-39)22-11-16(12-31)10-21(23(22)30)35-28-37-25(34-17-2-3-17)26-33-14-18(13-32)41(26)38-28/h10-11,14,17,19-20,24H,2-9,15H2,1H3,(H,36,44)(H,42,43)(H2,34,35,37,38)/t19-,20-,24?/m1/s1 |
| InChIKey | AXXKRUFDSOCFLF-GNPFLCDCSA-N |
| XLogP | 2.18 |
| TPSA | 206.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.10 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|