C16H17ClN4OS — CID 118264313
2-chloro-N-[[4-(dimethylamino)phenyl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 118264313) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is 2-chloro-N-[[4-(dimethylamino)phenyl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 2-chloro-N-[[4-(dimethylamino)phenyl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118264313 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-chloro-N-[[4-(dimethylamino)phenyl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2sc(Cl)cn2c1C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H17ClN4OS/c1-10-14(21-9-13(17)23-16(21)19-10)15(22)18-8-11-4-6-12(7-5-11)20(2)3/h4-7,9H,8H2,1-3H3,(H,18,22) |
| InChIKey | DZONSAXPRFNTKK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|