C21H26N4O2S — CID 118264362
N-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 118264362) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118264362 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1cn2c(C(=O)NCc3ccc(N4CC(C)OC(C)C4)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C21H26N4O2S/c1-13-10-24(11-14(2)27-13)18-7-5-17(6-8-18)9-22-20(26)19-16(4)23-21-25(19)12-15(3)28-21/h5-8,12-14H,9-11H2,1-4H3,(H,22,26) |
| InChIKey | SNVRKCGFUNVLRX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|