C23H26N4O2 — CID 91423005
1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-3-isoquinolin-1-ylurea (PubChem CID 91423005) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-3-isoquinolin-1-ylurea.
| Compound Name | 1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-3-isoquinolin-1-ylurea |
|---|---|
| PubChem CID | 91423005 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[[4-(2,6-dimethylmorpholin-4-yl)phenyl]methyl]-3-isoquinolin-1-ylurea |
| SMILES | CC1CN(c2ccc(CNC(=O)Nc3nccc4ccccc34)cc2)CC(C)O1 |
| InChI | InChI=1S/C23H26N4O2/c1-16-14-27(15-17(2)29-16)20-9-7-18(8-10-20)13-25-23(28)26-22-21-6-4-3-5-19(21)11-12-24-22/h3-12,16-17H,13-15H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | PUNMKEPBSGNJQW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|