C18H11F6N3O2 — CID 118267574
(E)-3-[5-[4-(trifluoromethoxy)-3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 118267574) has the molecular formula C18H11F6N3O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is (E)-3-[5-[4-(trifluoromethoxy)-3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(trifluoromethoxy)-3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267574 |
| Molecular Formula | C18H11F6N3O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (E)-3-[5-[4-(trifluoromethoxy)-3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(-c3ccc(OC(F)(F)F)c(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C18H11F6N3O2/c19-17(20,21)13-6-9(1-3-14(13)29-18(22,23)24)11-5-12-10(2-4-15(25)28)7-26-16(12)27-8-11/h1-8H,(H2,25,28)(H,26,27)/b4-2+ |
| InChIKey | ZHSIJWNDJRZDTQ-DUXPYHPUSA-N |
| XLogP | 4.65 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|