C13H15N3O3 — CID 118267964
(E)-3-[4-(1-hydroxypropan-2-yloxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 118267964) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (E)-3-[4-(1-hydroxypropan-2-yloxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(1-hydroxypropan-2-yloxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267964 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (E)-3-[4-(1-hydroxypropan-2-yloxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | CC(CO)Oc1ccnc2[nH]cc(/C=C/C(N)=O)c12 |
| InChI | InChI=1S/C13H15N3O3/c1-8(7-17)19-10-4-5-15-13-12(10)9(6-16-13)2-3-11(14)18/h2-6,8,17H,7H2,1H3,(H2,14,18)(H,15,16)/b3-2+ |
| InChIKey | FSBBLCKNIAAJTM-NSCUHMNNSA-N |
| XLogP | 0.82 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|