C13H18O2 — CID 118269443
4-ethenyl-2-ethoxy-1-propan-2-yloxybenzene (PubChem CID 118269443) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-ethenyl-2-ethoxy-1-propan-2-yloxybenzene.
| Compound Name | 4-ethenyl-2-ethoxy-1-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 118269443 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-ethenyl-2-ethoxy-1-propan-2-yloxybenzene |
| SMILES | C=Cc1ccc(OC(C)C)c(OCC)c1 |
| InChI | InChI=1S/C13H18O2/c1-5-11-7-8-12(15-10(3)4)13(9-11)14-6-2/h5,7-10H,1,6H2,2-4H3 |
| InChIKey | VQGBFUXDPHLRFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |