C16H26O3Si — CID 168749605
2-[(4-ethenyl-2-ethoxyphenoxy)methoxy]ethyl-trimethylsilane (PubChem CID 168749605) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is 2-[(4-ethenyl-2-ethoxyphenoxy)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-ethenyl-2-ethoxyphenoxy)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 168749605 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[(4-ethenyl-2-ethoxyphenoxy)methoxy]ethyl-trimethylsilane |
| SMILES | C=Cc1ccc(OCOCC[Si](C)(C)C)c(OCC)c1 |
| InChI | InChI=1S/C16H26O3Si/c1-6-14-8-9-15(16(12-14)18-7-2)19-13-17-10-11-20(3,4)5/h6,8-9,12H,1,7,10-11,13H2,2-5H3 |
| InChIKey | WWEKOPNDPIPMHY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|