C20H22F6N2O5 — CID 11826985
[(3R,6S)-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate (PubChem CID 11826985) has the molecular formula C20H22F6N2O5 and a molecular weight of 484.39 g/mol. Its IUPAC name is [(3R,6S)-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate.
| Compound Name | [(3R,6S)-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate |
|---|---|
| PubChem CID | 11826985 |
| Molecular Formula | C20H22F6N2O5 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [(3R,6S)-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]-3-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CN(C(=O)C(F)(F)F)[C@H](C)c2ccccc2)CC[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H22F6N2O5/c1-11(13-6-4-3-5-7-13)28(18(31)20(24,25)26)10-14-8-9-15(16(33-14)32-12(2)29)27-17(30)19(21,22)23/h3-7,11,14-16H,8-10H2,1-2H3,(H,27,30)/t11-,14+,15-,16?/m1/s1 |
| InChIKey | HTFQRUBQUFCEGN-AWVAWBNFSA-N |
| XLogP | 3.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |