C18H21F6NO4 — CID 11697647
N-[(2R,3R,4S,6S)-6-ethoxy-3-hydroxy-2-(trifluoromethyl)oxan-4-yl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 11697647) has the molecular formula C18H21F6NO4 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[(2R,3R,4S,6S)-6-ethoxy-3-hydroxy-2-(trifluoromethyl)oxan-4-yl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | N-[(2R,3R,4S,6S)-6-ethoxy-3-hydroxy-2-(trifluoromethyl)oxan-4-yl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 11697647 |
| Molecular Formula | C18H21F6NO4 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[(2R,3R,4S,6S)-6-ethoxy-3-hydroxy-2-(trifluoromethyl)oxan-4-yl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | CCO[C@@H]1C[C@H](N(C(=O)C(F)(F)F)[C@H](C)c2ccccc2)[C@@H](O)[C@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C18H21F6NO4/c1-3-28-13-9-12(14(26)15(29-13)17(19,20)21)25(16(27)18(22,23)24)10(2)11-7-5-4-6-8-11/h4-8,10,12-15,26H,3,9H2,1-2H3/t10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | YKGIPFMCWCUSJM-BGNCJLHMSA-N |
| XLogP | 3.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |