C25H32N2O4 — CID 118272526
[9-(diethylcarbamoyloxymethyl)fluoren-9-yl]methyl N,N-diethylcarbamate (PubChem CID 118272526) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [9-(diethylcarbamoyloxymethyl)fluoren-9-yl]methyl N,N-diethylcarbamate.
| Compound Name | [9-(diethylcarbamoyloxymethyl)fluoren-9-yl]methyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 118272526 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [9-(diethylcarbamoyloxymethyl)fluoren-9-yl]methyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCC1(COC(=O)N(CC)CC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H32N2O4/c1-5-26(6-2)23(28)30-17-25(18-31-24(29)27(7-3)8-4)21-15-11-9-13-19(21)20-14-10-12-16-22(20)25/h9-16H,5-8,17-18H2,1-4H3 |
| InChIKey | MXUWZBFPXQWQOC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |