C22H28ClF2N5O2S — CID 118272634
N-[(1R,2R)-2-[chloro-[2-[(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide (PubChem CID 118272634) has the molecular formula C22H28ClF2N5O2S and a molecular weight of 500.02 g/mol. Its IUPAC name is N-[(1R,2R)-2-[chloro-[2-[(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[(1R,2R)-2-[chloro-[2-[(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 118272634 |
| Molecular Formula | C22H28ClF2N5O2S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[(1R,2R)-2-[chloro-[2-[(7,7-difluoro-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCC[C@H]1N(Cl)c1ccnc(Nc2ccc3c(c2)CCC(F)(F)CC3)n1 |
| InChI | InChI=1S/C22H28ClF2N5O2S/c1-33(31,32)29-18-4-2-3-5-19(18)30(23)20-10-13-26-21(28-20)27-17-7-6-15-8-11-22(24,25)12-9-16(15)14-17/h6-7,10,13-14,18-19,29H,2-5,8-9,11-12H2,1H3,(H,26,27,28)/t18-,19-/m1/s1 |
| InChIKey | GNFNOPFQSBDNCY-RTBURBONSA-N |
| XLogP | 4.55 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|