C25H34ClF3N6O3S — CID 56666620
N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 56666620) has the molecular formula C25H34ClF3N6O3S and a molecular weight of 591.10 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 56666620 |
| Molecular Formula | C25H34ClF3N6O3S |
| Molecular Weight | 591.10 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | COCCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4NS(=O)(=O)CC(F)(F)F)n3)cc2CC1 |
| InChI | InChI=1S/C25H34ClF3N6O3S/c1-38-13-12-35-10-8-17-6-7-19(14-18(17)9-11-35)31-24-30-15-20(26)23(33-24)32-21-4-2-3-5-22(21)34-39(36,37)16-25(27,28)29/h6-7,14-15,21-22,34H,2-5,8-13,16H2,1H3,(H2,30,31,32,33)/t21-,22-/m1/s1 |
| InChIKey | WHUMNDGRLJYAMI-FGZHOGPDSA-N |
| XLogP | 4.13 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.10 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |