About (E)-1,2-dichlorohex-1-en-1-ol
(E)-1,2-dichlorohex-1-en-1-ol (PubChem CID 118276208) has the molecular formula C6H10Cl2O
and a molecular weight of 169.05 g/mol. Its IUPAC name is (E)-1,2-dichlorohex-1-en-1-ol.
Molecular Properties
| Compound Name | (E)-1,2-dichlorohex-1-en-1-ol |
| PubChem CID | 118276208 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (E)-1,2-dichlorohex-1-en-1-ol |
| SMILES | CCCC/C(Cl)=C(/O)Cl |
| InChI | InChI=1S/C6H10Cl2O/c1-2-3-4-5(7)6(8)9/h9H,2-4H2,1H3/b6-5- |
| InChIKey | WKSNXAQULMJXQN-WAYWQWQTSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-dichlorohex-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-dichlorohex-1-en-1-ol?
The IUPAC name of (E)-1,2-dichlorohex-1-en-1-ol (CID 118276208) is (E)-1,2-dichlorohex-1-en-1-ol.
What is the SMILES notation for (E)-1,2-dichlorohex-1-en-1-ol?
The canonical SMILES for (E)-1,2-dichlorohex-1-en-1-ol is CCCC/C(Cl)=C(/O)Cl.
What is the InChIKey of (E)-1,2-dichlorohex-1-en-1-ol?
The InChIKey is WKSNXAQULMJXQN-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H10Cl2O/c1-2-3-4-5(7)6(8)9/h9H,2-4H2,1H3/b6-5-.
What are the key properties of (E)-1,2-dichlorohex-1-en-1-ol?
(E)-1,2-dichlorohex-1-en-1-ol has a molecular weight of 169.05 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-dichlorohex-1-en-1-ol is sourced from PubChem (CID 118276208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).