C18H19Cl3N4O4Ru — CID 11827856
dichlororuthenium;tris(pyridin-2-ylmethyl)azanium;perchlorate (PubChem CID 11827856) has the molecular formula C18H19Cl3N4O4Ru and a molecular weight of 562.80 g/mol. Its IUPAC name is dichlororuthenium;tris(pyridin-2-ylmethyl)azanium;perchlorate.
| Compound Name | dichlororuthenium;tris(pyridin-2-ylmethyl)azanium;perchlorate |
|---|---|
| PubChem CID | 11827856 |
| Molecular Formula | C18H19Cl3N4O4Ru |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 561.95 |
| IUPAC Name | dichlororuthenium;tris(pyridin-2-ylmethyl)azanium;perchlorate |
| SMILES | Cl[Ru]Cl.[O-][Cl+3]([O-])([O-])[O-].c1ccc(C[NH+](Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C18H18N4.ClHO4.2ClH.Ru/c1-4-10-19-16(7-1)13-22(14-17-8-2-5-11-20-17)15-18-9-3-6-12-21-18;2-1(3,4)5;;;/h1-12H,13-15H2;(H,2,3,4,5);2*1H;/q;;;;+2/p-2 |
| InChIKey | PEHHTBOVJRFAJQ-UHFFFAOYSA-L |
| XLogP | -1.72 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |