C31H42BrNO2Si — CID 11827902
(4S)-2-(2-bromoprop-2-enyl)-4-[tert-butyl(diphenyl)silyl]oxy-1-pyrrolidin-1-yloct-7-en-1-one (PubChem CID 11827902) has the molecular formula C31H42BrNO2Si and a molecular weight of 568.67 g/mol. Its IUPAC name is (4S)-2-(2-bromoprop-2-enyl)-4-[tert-butyl(diphenyl)silyl]oxy-1-pyrrolidin-1-yloct-7-en-1-one.
| Compound Name | (4S)-2-(2-bromoprop-2-enyl)-4-[tert-butyl(diphenyl)silyl]oxy-1-pyrrolidin-1-yloct-7-en-1-one |
|---|---|
| PubChem CID | 11827902 |
| Molecular Formula | C31H42BrNO2Si |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | (4S)-2-(2-bromoprop-2-enyl)-4-[tert-butyl(diphenyl)silyl]oxy-1-pyrrolidin-1-yloct-7-en-1-one |
| SMILES | C=CCC[C@@H](CC(CC(=C)Br)C(=O)N1CCCC1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H42BrNO2Si/c1-6-7-16-27(24-26(23-25(2)32)30(34)33-21-14-15-22-33)35-36(31(3,4)5,28-17-10-8-11-18-28)29-19-12-9-13-20-29/h6,8-13,17-20,26-27H,1-2,7,14-16,21-24H2,3-5H3/t26?,27-/m0/s1 |
| InChIKey | BDQGIKVMOCAAEW-GEVKEYJPSA-N |
| XLogP | 6.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|