C31H43NO2Si — CID 101259555
(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-5-ethenylhept-6-en-1-one (PubChem CID 101259555) has the molecular formula C31H43NO2Si and a molecular weight of 489.78 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-5-ethenylhept-6-en-1-one.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-5-ethenylhept-6-en-1-one |
|---|---|
| PubChem CID | 101259555 |
| Molecular Formula | C31H43NO2Si |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-5-ethenylhept-6-en-1-one |
| SMILES | C=CC(C=C)[C@H](CCC(=O)N1[C@@H](C)CC[C@@H]1C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H43NO2Si/c1-8-26(9-2)29(22-23-30(33)32-24(3)20-21-25(32)4)34-35(31(5,6)7,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h8-19,24-26,29H,1-2,20-23H2,3-7H3/t24-,25-,29-/m0/s1 |
| InChIKey | YDDURPJWJWCERD-QEMZJVQQSA-N |
| XLogP | 6.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|