C22H29NO2Si — CID 141489122
(4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpyrrolidin-2-one (PubChem CID 141489122) has the molecular formula C22H29NO2Si and a molecular weight of 367.56 g/mol. Its IUPAC name is (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpyrrolidin-2-one.
| Compound Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 141489122 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpyrrolidin-2-one |
| SMILES | C[C@H]1NC(=O)C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H29NO2Si/c1-17-18(15-21(24)23-17)16-25-26(22(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | SFAQPUKZXFXSIS-QZTJIDSGSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|