C31H41NO2Si2 — CID 10768172
(3R,4S,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-[dimethyl(phenyl)silyl]-3-methylpyrrolidin-2-one (PubChem CID 10768172) has the molecular formula C31H41NO2Si2 and a molecular weight of 515.85 g/mol. Its IUPAC name is (3R,4S,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-[dimethyl(phenyl)silyl]-3-methylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-[dimethyl(phenyl)silyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10768172 |
| Molecular Formula | C31H41NO2Si2 |
| Molecular Weight | 515.85 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (3R,4S,5R)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-[dimethyl(phenyl)silyl]-3-methylpyrrolidin-2-one |
| SMILES | C[C@@H]1C(=O)N[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H41NO2Si2/c1-24-29(35(5,6)25-16-10-7-11-17-25)28(32-30(24)33)22-23-34-36(31(2,3)4,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,24,28-29H,22-23H2,1-6H3,(H,32,33)/t24-,28+,29-/m0/s1 |
| InChIKey | RNTQXMJCPPVNIA-DOUMQJFESA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|