C23H23NO2Si — CID 139660304
5-(triphenylsilyloxymethyl)pyrrolidin-2-one (PubChem CID 139660304) has the molecular formula C23H23NO2Si and a molecular weight of 373.53 g/mol. Its IUPAC name is 5-(triphenylsilyloxymethyl)pyrrolidin-2-one.
| Compound Name | 5-(triphenylsilyloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 139660304 |
| Molecular Formula | C23H23NO2Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-(triphenylsilyloxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C23H23NO2Si/c25-23-17-16-19(24-23)18-26-27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,19H,16-18H2,(H,24,25) |
| InChIKey | WZTRNGJZIUHPEJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|