C21H27NO3Si — CID 11003169
(4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxypyrrolidin-2-one (PubChem CID 11003169) has the molecular formula C21H27NO3Si and a molecular weight of 369.54 g/mol. Its IUPAC name is (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxypyrrolidin-2-one.
| Compound Name | (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11003169 |
| Molecular Formula | C21H27NO3Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1NC(=O)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3Si/c1-21(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-15-18-19(23)14-20(24)22-18/h4-13,18-19,23H,14-15H2,1-3H3,(H,22,24)/t18-,19+/m1/s1 |
| InChIKey | FOAUTOONVKEMBN-MOPGFXCFSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|