C28H43NO3Si — CID 57070793
N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypentan-2-yl]heptanamide (PubChem CID 57070793) has the molecular formula C28H43NO3Si and a molecular weight of 469.74 g/mol. Its IUPAC name is N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypentan-2-yl]heptanamide.
| Compound Name | N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 57070793 |
| Molecular Formula | C28H43NO3Si |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxypentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CC |
| InChI | InChI=1S/C28H43NO3Si/c1-6-8-9-16-21-27(31)29-25(26(30)7-2)22-32-33(28(3,4)5,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h10-15,17-20,25-26,30H,6-9,16,21-22H2,1-5H3,(H,29,31)/t25-,26+/m0/s1 |
| InChIKey | POHURFAJJICINL-IZZNHLLZSA-N |
| XLogP | 4.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|