C25H35NO2Si — CID 11589615
(5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-propylpiperidin-2-one (PubChem CID 11589615) has the molecular formula C25H35NO2Si and a molecular weight of 409.65 g/mol. Its IUPAC name is (5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-propylpiperidin-2-one.
| Compound Name | (5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-propylpiperidin-2-one |
|---|---|
| PubChem CID | 11589615 |
| Molecular Formula | C25H35NO2Si |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-propylpiperidin-2-one |
| SMILES | CCC[C@@H]1CCC(=O)N[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H35NO2Si/c1-5-12-20-17-18-24(27)26-23(20)19-28-29(25(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,20,23H,5,12,17-19H2,1-4H3,(H,26,27)/t20-,23-/m1/s1 |
| InChIKey | RDSMDYJJRYKHQH-NFBKMPQASA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|