C32H39NO2Si — CID 102046475
N,2-dicyclohexyl-2-triphenylsilyloxyacetamide (PubChem CID 102046475) has the molecular formula C32H39NO2Si and a molecular weight of 497.76 g/mol. Its IUPAC name is N,2-dicyclohexyl-2-triphenylsilyloxyacetamide.
| Compound Name | N,2-dicyclohexyl-2-triphenylsilyloxyacetamide |
|---|---|
| PubChem CID | 102046475 |
| Molecular Formula | C32H39NO2Si |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N,2-dicyclohexyl-2-triphenylsilyloxyacetamide |
| SMILES | O=C(NC1CCCCC1)C(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C32H39NO2Si/c34-32(33-27-18-8-2-9-19-27)31(26-16-6-1-7-17-26)35-36(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h3-5,10-15,20-27,31H,1-2,6-9,16-19H2,(H,33,34) |
| InChIKey | IGNWVSKWBHWYPA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|