C37H45NO2Si — CID 135004659
4-phenyl-N-(2,4,4-trimethylhexan-2-yl)-2-triphenylsilyloxybutanamide (PubChem CID 135004659) has the molecular formula C37H45NO2Si and a molecular weight of 563.86 g/mol. Its IUPAC name is 4-phenyl-N-(2,4,4-trimethylhexan-2-yl)-2-triphenylsilyloxybutanamide.
| Compound Name | 4-phenyl-N-(2,4,4-trimethylhexan-2-yl)-2-triphenylsilyloxybutanamide |
|---|---|
| PubChem CID | 135004659 |
| Molecular Formula | C37H45NO2Si |
| Molecular Weight | 563.86 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | 4-phenyl-N-(2,4,4-trimethylhexan-2-yl)-2-triphenylsilyloxybutanamide |
| SMILES | CCC(C)(C)CC(C)(C)NC(=O)C(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H45NO2Si/c1-6-36(2,3)29-37(4,5)38-35(39)34(28-27-30-19-11-7-12-20-30)40-41(31-21-13-8-14-22-31,32-23-15-9-16-24-32)33-25-17-10-18-26-33/h7-26,34H,6,27-29H2,1-5H3,(H,38,39) |
| InChIKey | FRNVVMKGEZPUPE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.86 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|