C39H51NO3Si2 — CID 102046473
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide (PubChem CID 102046473) has the molecular formula C39H51NO3Si2 and a molecular weight of 638.01 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide |
|---|---|
| PubChem CID | 102046473 |
| Molecular Formula | C39H51NO3Si2 |
| Molecular Weight | 638.01 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide |
| SMILES | CC(C)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)C(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H51NO3Si2/c1-31(2)36(30-42-44(6,7)39(3,4)5)40-38(41)37(29-28-32-20-12-8-13-21-32)43-45(33-22-14-9-15-23-33,34-24-16-10-17-25-34)35-26-18-11-19-27-35/h8-27,31,36-37H,28-30H2,1-7H3,(H,40,41)/t36-,37?/m1/s1 |
| InChIKey | YFKLPLGKOKNUCS-RKROREJRSA-N |
| XLogP | 6.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.01 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|