C20H33NO2Si — CID 57045421
(3S)-4-(2-phenylethyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one (PubChem CID 57045421) has the molecular formula C20H33NO2Si and a molecular weight of 347.58 g/mol. Its IUPAC name is (3S)-4-(2-phenylethyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one.
| Compound Name | (3S)-4-(2-phenylethyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one |
|---|---|
| PubChem CID | 57045421 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (3S)-4-(2-phenylethyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one |
| SMILES | CC(C)[Si](O[C@@H]1C(=O)NC1CCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33NO2Si/c1-14(2)24(15(3)4,16(5)6)23-19-18(21-20(19)22)13-12-17-10-8-7-9-11-17/h7-11,14-16,18-19H,12-13H2,1-6H3,(H,21,22)/t18?,19-/m0/s1 |
| InChIKey | LASRSMNUEBADTG-GGYWPGCISA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|