C34H35NO2Si — CID 102046477
(E)-N-cyclohexyl-4-phenyl-2-triphenylsilyloxybut-3-enamide (PubChem CID 102046477) has the molecular formula C34H35NO2Si and a molecular weight of 517.75 g/mol. Its IUPAC name is (E)-N-cyclohexyl-4-phenyl-2-triphenylsilyloxybut-3-enamide.
| Compound Name | (E)-N-cyclohexyl-4-phenyl-2-triphenylsilyloxybut-3-enamide |
|---|---|
| PubChem CID | 102046477 |
| Molecular Formula | C34H35NO2Si |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (E)-N-cyclohexyl-4-phenyl-2-triphenylsilyloxybut-3-enamide |
| SMILES | O=C(NC1CCCCC1)C(/C=C/c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35NO2Si/c36-34(35-29-18-8-2-9-19-29)33(27-26-28-16-6-1-7-17-28)37-38(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1,3-7,10-17,20-27,29,33H,2,8-9,18-19H2,(H,35,36)/b27-26+ |
| InChIKey | PNDUIJVJCSBFGI-CYYJNZCTSA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|