C30H29N3O2 — CID 154707344
(E)-N-[1-(4-cyanophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N,3-diphenylprop-2-enamide (PubChem CID 154707344) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (E)-N-[1-(4-cyanophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[1-(4-cyanophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 154707344 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (E)-N-[1-(4-cyanophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N,3-diphenylprop-2-enamide |
| SMILES | N#Cc1ccc(C(C(=O)NC2CCCCC2)N(C(=O)/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N3O2/c31-22-24-16-19-25(20-17-24)29(30(35)32-26-12-6-2-7-13-26)33(27-14-8-3-9-15-27)28(34)21-18-23-10-4-1-5-11-23/h1,3-5,8-11,14-21,26,29H,2,6-7,12-13H2,(H,32,35)/b21-18+ |
| InChIKey | GOJACLXSWUNKAG-DYTRJAOYSA-N |
| XLogP | 5.79 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|