C23H28N2O — CID 4177936
N-cyclopentyl-2-(4-methylphenyl)-2-(N-prop-2-enylanilino)acetamide (PubChem CID 4177936) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N-cyclopentyl-2-(4-methylphenyl)-2-(N-prop-2-enylanilino)acetamide.
| Compound Name | N-cyclopentyl-2-(4-methylphenyl)-2-(N-prop-2-enylanilino)acetamide |
|---|---|
| PubChem CID | 4177936 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-cyclopentyl-2-(4-methylphenyl)-2-(N-prop-2-enylanilino)acetamide |
| SMILES | C=CCN(c1ccccc1)C(C(=O)NC1CCCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-3-17-25(21-11-5-4-6-12-21)22(19-15-13-18(2)14-16-19)23(26)24-20-9-7-8-10-20/h3-6,11-16,20,22H,1,7-10,17H2,2H3,(H,24,26) |
| InChIKey | CJLCBELYETZERL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|