C23H28N2O4 — CID 50992708
(2S)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-hydroxy-N-(2-hydroxyphenyl)propanamide (PubChem CID 50992708) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-hydroxy-N-(2-hydroxyphenyl)propanamide.
| Compound Name | (2S)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-hydroxy-N-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 50992708 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-hydroxy-N-(2-hydroxyphenyl)propanamide |
| SMILES | C[C@H](O)C(=O)N(c1ccccc1O)C(C(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-16(26)23(29)25(19-14-8-9-15-20(19)27)21(17-10-4-2-5-11-17)22(28)24-18-12-6-3-7-13-18/h2,4-5,8-11,14-16,18,21,26-27H,3,6-7,12-13H2,1H3,(H,24,28)/t16-,21?/m0/s1 |
| InChIKey | VQOONLWQDGCMKA-BJQOMGFOSA-N |
| XLogP | 3.30 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |