C26H28N2O4 — CID 3197045
N-[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-(2-ethoxyphenyl)furan-2-carboxamide (PubChem CID 3197045) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-(2-ethoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-(2-ethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3197045 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-(2-ethoxyphenyl)furan-2-carboxamide |
| SMILES | CCOc1ccccc1N(C(=O)c1ccco1)C(C(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c1-2-31-22-16-9-8-15-21(22)28(26(30)23-17-10-18-32-23)24(19-11-4-3-5-12-19)25(29)27-20-13-6-7-14-20/h3-5,8-12,15-18,20,24H,2,6-7,13-14H2,1H3,(H,27,29) |
| InChIKey | FZLUQXUXNUXNJR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |