C27H29N3O4 — CID 3191249
N-(4-acetamidophenyl)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide (PubChem CID 3191249) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3191249 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-(4-acetamidophenyl)-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(N(C(=O)c2ccco2)C(C(=O)NC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-19(31)28-22-14-16-23(17-15-22)30(27(33)24-13-8-18-34-24)25(20-9-4-2-5-10-20)26(32)29-21-11-6-3-7-12-21/h2,4-5,8-10,13-18,21,25H,3,6-7,11-12H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | LEPAZOGMYBHTBI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |