C25H25ClN2O3 — CID 1441687
N-(3-chlorophenyl)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide (PubChem CID 1441687) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1441687 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-phenylethyl]furan-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](c1ccccc1)N(C(=O)c1ccco1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H25ClN2O3/c26-19-11-7-14-21(17-19)28(25(30)22-15-8-16-31-22)23(18-9-3-1-4-10-18)24(29)27-20-12-5-2-6-13-20/h1,3-4,7-11,14-17,20,23H,2,5-6,12-13H2,(H,27,29)/t23-/m1/s1 |
| InChIKey | ORNKNVFQCSXOAX-HSZRJFAPSA-N |
| XLogP | 5.77 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |