C30H37NO2Si — CID 102046476
N-cyclohexyl-3,3-dimethyl-2-triphenylsilyloxybutanamide (PubChem CID 102046476) has the molecular formula C30H37NO2Si and a molecular weight of 471.72 g/mol. Its IUPAC name is N-cyclohexyl-3,3-dimethyl-2-triphenylsilyloxybutanamide.
| Compound Name | N-cyclohexyl-3,3-dimethyl-2-triphenylsilyloxybutanamide |
|---|---|
| PubChem CID | 102046476 |
| Molecular Formula | C30H37NO2Si |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-cyclohexyl-3,3-dimethyl-2-triphenylsilyloxybutanamide |
| SMILES | CC(C)(C)C(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H37NO2Si/c1-30(2,3)28(29(32)31-24-16-8-4-9-17-24)33-34(25-18-10-5-11-19-25,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h5-7,10-15,18-24,28H,4,8-9,16-17H2,1-3H3,(H,31,32) |
| InChIKey | RPGBJVZEXYUPAW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|