C24H25Cl3N2O2 — CID 15365094
(E)-N-cyclohexyl-2-(3,5-dichloro-N-(2-chloroacetyl)anilino)-4-phenylbut-3-enamide (PubChem CID 15365094) has the molecular formula C24H25Cl3N2O2 and a molecular weight of 479.84 g/mol. Its IUPAC name is (E)-N-cyclohexyl-2-(3,5-dichloro-N-(2-chloroacetyl)anilino)-4-phenylbut-3-enamide.
| Compound Name | (E)-N-cyclohexyl-2-(3,5-dichloro-N-(2-chloroacetyl)anilino)-4-phenylbut-3-enamide |
|---|---|
| PubChem CID | 15365094 |
| Molecular Formula | C24H25Cl3N2O2 |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | (E)-N-cyclohexyl-2-(3,5-dichloro-N-(2-chloroacetyl)anilino)-4-phenylbut-3-enamide |
| SMILES | O=C(NC1CCCCC1)C(/C=C/c1ccccc1)N(C(=O)CCl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H25Cl3N2O2/c25-16-23(30)29(21-14-18(26)13-19(27)15-21)22(12-11-17-7-3-1-4-8-17)24(31)28-20-9-5-2-6-10-20/h1,3-4,7-8,11-15,20,22H,2,5-6,9-10,16H2,(H,28,31)/b12-11+ |
| InChIKey | GUOSTYFMWJNAJC-VAWYXSNFSA-N |
| XLogP | 6.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|