C32H33NO2Si — CID 102046478
N-cyclohexyl-2-phenyl-2-triphenylsilyloxyacetamide (PubChem CID 102046478) has the molecular formula C32H33NO2Si and a molecular weight of 491.71 g/mol. Its IUPAC name is N-cyclohexyl-2-phenyl-2-triphenylsilyloxyacetamide.
| Compound Name | N-cyclohexyl-2-phenyl-2-triphenylsilyloxyacetamide |
|---|---|
| PubChem CID | 102046478 |
| Molecular Formula | C32H33NO2Si |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-cyclohexyl-2-phenyl-2-triphenylsilyloxyacetamide |
| SMILES | O=C(NC1CCCCC1)C(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33NO2Si/c34-32(33-27-18-8-2-9-19-27)31(26-16-6-1-7-17-26)35-36(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1,3-7,10-17,20-25,27,31H,2,8-9,18-19H2,(H,33,34) |
| InChIKey | RXSDRZSYJDXZQV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|