C45H59FN2O4Si — CID 149337284
methyl N-[(2S,9S)-10-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-9-(3-methylbutylamino)-3-oxo-1,1-diphenyldecan-2-yl]carbamate (PubChem CID 149337284) has the molecular formula C45H59FN2O4Si and a molecular weight of 739.06 g/mol. Its IUPAC name is methyl N-[(2S,9S)-10-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-9-(3-methylbutylamino)-3-oxo-1,1-diphenyldecan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,9S)-10-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-9-(3-methylbutylamino)-3-oxo-1,1-diphenyldecan-2-yl]carbamate |
|---|---|
| PubChem CID | 149337284 |
| Molecular Formula | C45H59FN2O4Si |
| Molecular Weight | 739.06 g/mol |
| Exact Mass | 738.42 |
| IUPAC Name | methyl N-[(2S,9S)-10-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-9-(3-methylbutylamino)-3-oxo-1,1-diphenyldecan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)CCC(F)CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NCCC(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H59FN2O4Si/c1-34(2)31-32-47-38(33-52-53(45(3,4)5,39-23-15-9-16-24-39)40-25-17-10-18-26-40)29-27-37(46)28-30-41(49)43(48-44(50)51-6)42(35-19-11-7-12-20-35)36-21-13-8-14-22-36/h7-26,34,37-38,42-43,47H,27-33H2,1-6H3,(H,48,50)/t37?,38-,43+/m0/s1 |
| InChIKey | YDMJRTDJJKHSDK-WZPNQEGDSA-N |
| XLogP | 8.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.06 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|