C26H32F2N2O5 — CID 157250882
ethyl (2S,9S)-2-amino-4,4-difluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecanoate (PubChem CID 157250882) has the molecular formula C26H32F2N2O5 and a molecular weight of 490.55 g/mol. Its IUPAC name is ethyl (2S,9S)-2-amino-4,4-difluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecanoate.
| Compound Name | ethyl (2S,9S)-2-amino-4,4-difluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecanoate |
|---|---|
| PubChem CID | 157250882 |
| Molecular Formula | C26H32F2N2O5 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | ethyl (2S,9S)-2-amino-4,4-difluoro-9-(methoxycarbonylamino)-8-oxo-10,10-diphenyldecanoate |
| SMILES | CCOC(=O)[C@@H](N)CC(F)(F)CCCC(=O)[C@@H](NC(=O)OC)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32F2N2O5/c1-3-35-24(32)20(29)17-26(27,28)16-10-15-21(31)23(30-25(33)34-2)22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20,22-23H,3,10,15-17,29H2,1-2H3,(H,30,33)/t20-,23+/m0/s1 |
| InChIKey | AWIFQCDCHIVORW-NZQKXSOJSA-N |
| XLogP | 4.20 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |