C44H58FN3O4Si — CID 123255270
methyl N-[1-[[6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-5-(3-methylbutylamino)hexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 123255270) has the molecular formula C44H58FN3O4Si and a molecular weight of 740.05 g/mol. Its IUPAC name is methyl N-[1-[[6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-5-(3-methylbutylamino)hexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-5-(3-methylbutylamino)hexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123255270 |
| Molecular Formula | C44H58FN3O4Si |
| Molecular Weight | 740.05 g/mol |
| Exact Mass | 739.42 |
| IUPAC Name | methyl N-[1-[[6-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-5-(3-methylbutylamino)hexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)NCC(F)CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NCCC(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H58FN3O4Si/c1-33(2)29-30-46-37(32-52-53(44(3,4)5,38-23-15-9-16-24-38)39-25-17-10-18-26-39)28-27-36(45)31-47-42(49)41(48-43(50)51-6)40(34-19-11-7-12-20-34)35-21-13-8-14-22-35/h7-26,33,36-37,40-41,46H,27-32H2,1-6H3,(H,47,49)(H,48,50) |
| InChIKey | FCQFHQHXWNAKBH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.05 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|